C26H27ClN6O4S — CID 42758751
[4-[(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)sulfanylmethyl]phenyl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 42758751) has the molecular formula C26H27ClN6O4S and a molecular weight of 555.06 g/mol. Its IUPAC name is [4-[(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)sulfanylmethyl]phenyl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [4-[(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)sulfanylmethyl]phenyl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42758751 |
| Molecular Formula | C26H27ClN6O4S |
| Molecular Weight | 555.06 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | [4-[(4-chloro-6-morpholin-4-ylpyrimidin-2-yl)sulfanylmethyl]phenyl]-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(CSc2nc(Cl)cc(N3CCOCC3)n2)cc1)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C26H27ClN6O4S/c27-23-17-24(31-13-15-37-16-14-31)29-26(28-23)38-18-19-1-3-20(4-2-19)25(34)32-11-9-30(10-12-32)21-5-7-22(8-6-21)33(35)36/h1-8,17H,9-16,18H2 |
| InChIKey | YHTPXJWSRSYMML-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 104.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.06 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|