C10H10N2OS2 — CID 4021748
4-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-one (PubChem CID 4021748) has the molecular formula C10H10N2OS2 and a molecular weight of 238.34 g/mol. Its IUPAC name is 4-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-one.
| Compound Name | 4-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 4021748 |
| Molecular Formula | C10H10N2OS2 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 4-sulfanylidene-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-d]pyrimidin-2-one |
| SMILES | O=c1[nH]c(=S)c2c3c(sc2[nH]1)CCCC3 |
| InChI | InChI=1S/C10H10N2OS2/c13-10-11-8(14)7-5-3-1-2-4-6(5)15-9(7)12-10/h1-4H2,(H2,11,12,13,14) |
| InChIKey | GNGGPLINRDKFAV-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|