C10H9KN2S3 — CID 46934377
potassium 4-sulfanylidene-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidine-2-thiolate (PubChem CID 46934377) has the molecular formula C10H9KN2S3 and a molecular weight of 292.50 g/mol. Its IUPAC name is potassium 4-sulfanylidene-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidine-2-thiolate.
| Compound Name | potassium 4-sulfanylidene-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidine-2-thiolate |
|---|---|
| PubChem CID | 46934377 |
| Molecular Formula | C10H9KN2S3 |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 291.96 |
| IUPAC Name | potassium 4-sulfanylidene-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidine-2-thiolate |
| SMILES | S=c1[nH]c([S-])nc2sc3c(c12)CCCC3.[K+] |
| InChI | InChI=1S/C10H10N2S3.K/c13-8-7-5-3-1-2-4-6(5)15-9(7)12-10(14)11-8;/h1-4H2,(H2,11,12,13,14);/q;+1/p-1 |
| InChIKey | FEQDYEYZXISMIV-UHFFFAOYSA-M |
| XLogP | 0.14 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|