C16H14ClN3S2 — CID 3005175
4-(4-chloroanilino)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidine-2-thione (PubChem CID 3005175) has the molecular formula C16H14ClN3S2 and a molecular weight of 347.90 g/mol. Its IUPAC name is 4-(4-chloroanilino)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidine-2-thione.
| Compound Name | 4-(4-chloroanilino)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 3005175 |
| Molecular Formula | C16H14ClN3S2 |
| Molecular Weight | 347.90 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 4-(4-chloroanilino)-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidine-2-thione |
| SMILES | S=c1nc2sc3c(c2c(Nc2ccc(Cl)cc2)[nH]1)CCCC3 |
| InChI | InChI=1S/C16H14ClN3S2/c17-9-5-7-10(8-6-9)18-14-13-11-3-1-2-4-12(11)22-15(13)20-16(21)19-14/h5-8H,1-4H2,(H2,18,19,20,21) |
| InChIKey | IFCMUBBXAZVPGB-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.90 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|