C28H22ClN3S — CID 2128513
N-benzhydryl-10-(4-chlorophenyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine (PubChem CID 2128513) has the molecular formula C28H22ClN3S and a molecular weight of 468.03 g/mol. Its IUPAC name is N-benzhydryl-10-(4-chlorophenyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine.
| Compound Name | N-benzhydryl-10-(4-chlorophenyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
|---|---|
| PubChem CID | 2128513 |
| Molecular Formula | C28H22ClN3S |
| Molecular Weight | 468.03 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | N-benzhydryl-10-(4-chlorophenyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-amine |
| SMILES | Clc1ccc(-c2nc(NC(c3ccccc3)c3ccccc3)c3c4c(sc3n2)CCC4)cc1 |
| InChI | InChI=1S/C28H22ClN3S/c29-21-16-14-20(15-17-21)26-31-27(24-22-12-7-13-23(22)33-28(24)32-26)30-25(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-6,8-11,14-17,25H,7,12-13H2,(H,30,31,32) |
| InChIKey | TWAXLFMKEZMOFC-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.03 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |