C16H13ClN6S — CID 15644227
2-azido-N-(4-chlorophenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (PubChem CID 15644227) has the molecular formula C16H13ClN6S and a molecular weight of 356.84 g/mol. Its IUPAC name is 2-azido-N-(4-chlorophenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-azido-N-(4-chlorophenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 15644227 |
| Molecular Formula | C16H13ClN6S |
| Molecular Weight | 356.84 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 2-azido-N-(4-chlorophenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| SMILES | [N-]=[N+]=Nc1nc(Nc2ccc(Cl)cc2)c2c3c(sc2n1)CCCC3 |
| InChI | InChI=1S/C16H13ClN6S/c17-9-5-7-10(8-6-9)19-14-13-11-3-1-2-4-12(11)24-15(13)21-16(20-14)22-23-18/h5-8H,1-4H2,(H,19,20,21) |
| InChIKey | UCSIZAURBWKFNQ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 86.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.84 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|