C15H12ClN3OS — CID 93214043
3-[(10-chloro-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]phenol (PubChem CID 93214043) has the molecular formula C15H12ClN3OS and a molecular weight of 317.80 g/mol. Its IUPAC name is 3-[(10-chloro-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]phenol.
| Compound Name | 3-[(10-chloro-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]phenol |
|---|---|
| PubChem CID | 93214043 |
| Molecular Formula | C15H12ClN3OS |
| Molecular Weight | 317.80 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 3-[(10-chloro-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]phenol |
| SMILES | Oc1cccc(Nc2nc(Cl)nc3sc4c(c23)CCC4)c1 |
| InChI | InChI=1S/C15H12ClN3OS/c16-15-18-13(17-8-3-1-4-9(20)7-8)12-10-5-2-6-11(10)21-14(12)19-15/h1,3-4,7,20H,2,5-6H2,(H,17,18,19) |
| InChIKey | LJPZFQSOMHSPJI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.80 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |