C17H16ClN3OS — CID 82065936
4-[(2-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]-3-methylphenol (PubChem CID 82065936) has the molecular formula C17H16ClN3OS and a molecular weight of 345.86 g/mol. Its IUPAC name is 4-[(2-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]-3-methylphenol.
| Compound Name | 4-[(2-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]-3-methylphenol |
|---|---|
| PubChem CID | 82065936 |
| Molecular Formula | C17H16ClN3OS |
| Molecular Weight | 345.86 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 4-[(2-chloro-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)amino]-3-methylphenol |
| SMILES | Cc1cc(O)ccc1Nc1nc(Cl)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C17H16ClN3OS/c1-9-8-10(22)6-7-12(9)19-15-14-11-4-2-3-5-13(11)23-16(14)21-17(18)20-15/h6-8,22H,2-5H2,1H3,(H,19,20,21) |
| InChIKey | HKFSUINLHWBTJM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.86 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|