C21H26N4S — CID 23850502
4-N,4-N-diethyl-2-methyl-1-N-(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)benzene-1,4-diamine (PubChem CID 23850502) has the molecular formula C21H26N4S and a molecular weight of 366.53 g/mol. Its IUPAC name is 4-N,4-N-diethyl-2-methyl-1-N-(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)benzene-1,4-diamine.
| Compound Name | 4-N,4-N-diethyl-2-methyl-1-N-(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 23850502 |
| Molecular Formula | C21H26N4S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 4-N,4-N-diethyl-2-methyl-1-N-(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)benzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(Nc2nc(C)nc3sc4c(c23)CCC4)c(C)c1 |
| InChI | InChI=1S/C21H26N4S/c1-5-25(6-2)15-10-11-17(13(3)12-15)24-20-19-16-8-7-9-18(16)26-21(19)23-14(4)22-20/h10-12H,5-9H2,1-4H3,(H,22,23,24) |
| InChIKey | JGPBARVWADDLKA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|