C19H20N4O2S — CID 30807108
2-methoxy-N-[4-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]phenyl]acetamide (PubChem CID 30807108) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 2-methoxy-N-[4-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]phenyl]acetamide.
| Compound Name | 2-methoxy-N-[4-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]phenyl]acetamide |
|---|---|
| PubChem CID | 30807108 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-methoxy-N-[4-[(10-methyl-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)amino]phenyl]acetamide |
| SMILES | COCC(=O)Nc1ccc(Nc2nc(C)nc3sc4c(c23)CCC4)cc1 |
| InChI | InChI=1S/C19H20N4O2S/c1-11-20-18(17-14-4-3-5-15(14)26-19(17)21-11)23-13-8-6-12(7-9-13)22-16(24)10-25-2/h6-9H,3-5,10H2,1-2H3,(H,22,24)(H,20,21,23) |
| InChIKey | RYHGLDCZJJQWGO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |