C18H18ClN3S — CID 82066158
5-chloro-N-(2-methylphenyl)-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-amine (PubChem CID 82066158) has the molecular formula C18H18ClN3S and a molecular weight of 343.88 g/mol. Its IUPAC name is 5-chloro-N-(2-methylphenyl)-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-amine.
| Compound Name | 5-chloro-N-(2-methylphenyl)-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-amine |
|---|---|
| PubChem CID | 82066158 |
| Molecular Formula | C18H18ClN3S |
| Molecular Weight | 343.88 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 5-chloro-N-(2-methylphenyl)-8-thia-4,6-diazatricyclo[7.5.0.02,7]tetradeca-1(9),2,4,6-tetraen-3-amine |
| SMILES | Cc1ccccc1Nc1nc(Cl)nc2sc3c(c12)CCCCC3 |
| InChI | InChI=1S/C18H18ClN3S/c1-11-7-5-6-9-13(11)20-16-15-12-8-3-2-4-10-14(12)23-17(15)22-18(19)21-16/h5-7,9H,2-4,8,10H2,1H3,(H,20,21,22) |
| InChIKey | RWMYUBWORMJYOT-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.88 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |