C10H10N2S3 — CID 1180504
4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d][1,3]thiazine-2-thione (PubChem CID 1180504) has the molecular formula C10H10N2S3 and a molecular weight of 254.40 g/mol. Its IUPAC name is 4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d][1,3]thiazine-2-thione.
| Compound Name | 4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d][1,3]thiazine-2-thione |
|---|---|
| PubChem CID | 1180504 |
| Molecular Formula | C10H10N2S3 |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | 4-amino-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d][1,3]thiazine-2-thione |
| SMILES | Nc1sc(=S)nc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C10H10N2S3/c11-8-7-5-3-1-2-4-6(5)14-9(7)12-10(13)15-8/h1-4,11H2 |
| InChIKey | IEKLPOJJSKPQJQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|