C16H15N3S2 — CID 15628970
4-amino-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione (PubChem CID 15628970) has the molecular formula C16H15N3S2 and a molecular weight of 313.45 g/mol. Its IUPAC name is 4-amino-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione.
| Compound Name | 4-amino-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 15628970 |
| Molecular Formula | C16H15N3S2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 4-amino-3-phenyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-2-thione |
| SMILES | Nc1c2c3c(sc2nc(=S)n1-c1ccccc1)CCCC3 |
| InChI | InChI=1S/C16H15N3S2/c17-14-13-11-8-4-5-9-12(11)21-15(13)18-16(20)19(14)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9,17H2 |
| InChIKey | VMVKOIINQHNKQP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|