C23H26N4S3 — CID 57341529
27-amino-11,17-dithia-13,15,28-triazahexacyclo[13.13.0.02,12.03,10.016,26.018,25]octacosa-1,3(10),12,16(26),18(25),27-hexaene-14-thione (PubChem CID 57341529) has the molecular formula C23H26N4S3 and a molecular weight of 454.69 g/mol. Its IUPAC name is 27-amino-11,17-dithia-13,15,28-triazahexacyclo[13.13.0.02,12.03,10.016,26.018,25]octacosa-1,3(10),12,16(26),18(25),27-hexaene-14-thione.
| Compound Name | 27-amino-11,17-dithia-13,15,28-triazahexacyclo[13.13.0.02,12.03,10.016,26.018,25]octacosa-1,3(10),12,16(26),18(25),27-hexaene-14-thione |
|---|---|
| PubChem CID | 57341529 |
| Molecular Formula | C23H26N4S3 |
| Molecular Weight | 454.69 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 27-amino-11,17-dithia-13,15,28-triazahexacyclo[13.13.0.02,12.03,10.016,26.018,25]octacosa-1,3(10),12,16(26),18(25),27-hexaene-14-thione |
| SMILES | Nc1nc2c3c4c(sc3nc(=S)n2c2sc3c(c12)CCCCCC3)CCCCCC4 |
| InChI | InChI=1S/C23H26N4S3/c24-19-17-13-9-5-1-4-8-12-16(13)30-22(17)27-20(25-19)18-14-10-6-2-3-7-11-15(14)29-21(18)26-23(27)28/h1-12H2,(H2,24,25) |
| InChIKey | DDKQTVJLSNAHKR-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.69 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|