C16H13N5S2 — CID 24851008
7-pyridin-4-yl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraene-5-thione (PubChem CID 24851008) has the molecular formula C16H13N5S2 and a molecular weight of 339.45 g/mol. Its IUPAC name is 7-pyridin-4-yl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraene-5-thione.
| Compound Name | 7-pyridin-4-yl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraene-5-thione |
|---|---|
| PubChem CID | 24851008 |
| Molecular Formula | C16H13N5S2 |
| Molecular Weight | 339.45 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 7-pyridin-4-yl-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraene-5-thione |
| SMILES | S=c1[nH]nc2c3c4c(sc3nc(-c3ccncc3)n12)CCCC4 |
| InChI | InChI=1S/C16H13N5S2/c22-16-20-19-14-12-10-3-1-2-4-11(10)23-15(12)18-13(21(14)16)9-5-7-17-8-6-9/h5-8H,1-4H2,(H,20,22) |
| InChIKey | URFPXLHMVKUVCS-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|