C26H21F3N2O5S — CID 4022842
[2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzoate (PubChem CID 4022842) has the molecular formula C26H21F3N2O5S and a molecular weight of 530.52 g/mol. Its IUPAC name is [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzoate.
| Compound Name | [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 4022842 |
| Molecular Formula | C26H21F3N2O5S |
| Molecular Weight | 530.52 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | [2-oxo-2-(1,2,3,4-tetrahydronaphthalen-1-ylamino)ethyl] 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzoate |
| SMILES | O=C(COC(=O)c1ccccc1Sc1ccc(C(F)(F)F)cc1[N+](=O)[O-])NC1CCCc2ccccc21 |
| InChI | InChI=1S/C26H21F3N2O5S/c27-26(28,29)17-12-13-23(21(14-17)31(34)35)37-22-11-4-3-9-19(22)25(33)36-15-24(32)30-20-10-5-7-16-6-1-2-8-18(16)20/h1-4,6,8-9,11-14,20H,5,7,10,15H2,(H,30,32) |
| InChIKey | ZTIABFYOFXBAJF-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.52 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|