C22H20F3N3O6S — CID 4551651
[2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzoate (PubChem CID 4551651) has the molecular formula C22H20F3N3O6S and a molecular weight of 511.48 g/mol. Its IUPAC name is [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzoate.
| Compound Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 4551651 |
| Molecular Formula | C22H20F3N3O6S |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 511.10 |
| IUPAC Name | [2-(cyclopentylcarbamoylamino)-2-oxoethyl] 2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanylbenzoate |
| SMILES | O=C(COC(=O)c1ccccc1Sc1ccc(C(F)(F)F)cc1[N+](=O)[O-])NC(=O)NC1CCCC1 |
| InChI | InChI=1S/C22H20F3N3O6S/c23-22(24,25)13-9-10-18(16(11-13)28(32)33)35-17-8-4-3-7-15(17)20(30)34-12-19(29)27-21(31)26-14-5-1-2-6-14/h3-4,7-11,14H,1-2,5-6,12H2,(H2,26,27,29,31) |
| InChIKey | WHNGVYHIERRMRK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|