C19H18N2O7S2 — CID 3987014
[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3-nitro-4-phenylsulfanylbenzoate (PubChem CID 3987014) has the molecular formula C19H18N2O7S2 and a molecular weight of 450.49 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3-nitro-4-phenylsulfanylbenzoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3-nitro-4-phenylsulfanylbenzoate |
|---|---|
| PubChem CID | 3987014 |
| Molecular Formula | C19H18N2O7S2 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 3-nitro-4-phenylsulfanylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(Sc2ccccc2)c([N+](=O)[O-])c1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H18N2O7S2/c22-18(20-14-8-9-30(26,27)12-14)11-28-19(23)13-6-7-17(16(10-13)21(24)25)29-15-4-2-1-3-5-15/h1-7,10,14H,8-9,11-12H2,(H,20,22) |
| InChIKey | UKYHACQJNKLBFL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|