C17H20N2O8S — CID 2475979
[2-(cyclohexanecarbonylamino)-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 2475979) has the molecular formula C17H20N2O8S and a molecular weight of 412.42 g/mol. Its IUPAC name is [2-(cyclohexanecarbonylamino)-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | [2-(cyclohexanecarbonylamino)-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 2475979 |
| Molecular Formula | C17H20N2O8S |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | [2-(cyclohexanecarbonylamino)-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | CS(=O)(=O)c1ccc(C(=O)OCC(=O)NC(=O)C2CCCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H20N2O8S/c1-28(25,26)14-8-7-12(9-13(14)19(23)24)17(22)27-10-15(20)18-16(21)11-5-3-2-4-6-11/h7-9,11H,2-6,10H2,1H3,(H,18,20,21) |
| InChIKey | LEYNGEDUUFUPRM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 149.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|