C24H32F3N3O9S — CID 56643191
[2-[4-(2-cyclohexylethyl)piperazin-1-yl]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate;2,2,2-trifluoroacetic acid (PubChem CID 56643191) has the molecular formula C24H32F3N3O9S and a molecular weight of 595.59 g/mol. Its IUPAC name is [2-[4-(2-cyclohexylethyl)piperazin-1-yl]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate;2,2,2-trifluoroacetic acid.
| Compound Name | [2-[4-(2-cyclohexylethyl)piperazin-1-yl]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 56643191 |
| Molecular Formula | C24H32F3N3O9S |
| Molecular Weight | 595.59 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | [2-[4-(2-cyclohexylethyl)piperazin-1-yl]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate;2,2,2-trifluoroacetic acid |
| SMILES | CS(=O)(=O)c1ccc(C(=O)OCC(=O)N2CCN(CCC3CCCCC3)CC2)cc1[N+](=O)[O-].O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H31N3O7S.C2HF3O2/c1-33(30,31)20-8-7-18(15-19(20)25(28)29)22(27)32-16-21(26)24-13-11-23(12-14-24)10-9-17-5-3-2-4-6-17;3-2(4,5)1(6)7/h7-8,15,17H,2-6,9-14,16H2,1H3;(H,6,7) |
| InChIKey | XOZSNRAMJJLMMU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 164.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.59 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|