C14H18N2O7S — CID 2620272
[2-(diethylamino)-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 2620272) has the molecular formula C14H18N2O7S and a molecular weight of 358.37 g/mol. Its IUPAC name is [2-(diethylamino)-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | [2-(diethylamino)-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 2620272 |
| Molecular Formula | C14H18N2O7S |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | [2-(diethylamino)-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | CCN(CC)C(=O)COC(=O)c1ccc(S(C)(=O)=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H18N2O7S/c1-4-15(5-2)13(17)9-23-14(18)10-6-7-12(24(3,21)22)11(8-10)16(19)20/h6-8H,4-5,9H2,1-3H3 |
| InChIKey | PWSUGKSJPAEWFQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|