C14H16N2O7S — CID 2409538
(2-oxo-2-pyrrolidin-1-ylethyl) 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 2409538) has the molecular formula C14H16N2O7S and a molecular weight of 356.36 g/mol. Its IUPAC name is (2-oxo-2-pyrrolidin-1-ylethyl) 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | (2-oxo-2-pyrrolidin-1-ylethyl) 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 2409538 |
| Molecular Formula | C14H16N2O7S |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | (2-oxo-2-pyrrolidin-1-ylethyl) 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | CS(=O)(=O)c1ccc(C(=O)OCC(=O)N2CCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16N2O7S/c1-24(21,22)12-5-4-10(8-11(12)16(19)20)14(18)23-9-13(17)15-6-2-3-7-15/h4-5,8H,2-3,6-7,9H2,1H3 |
| InChIKey | OIFKLZPDQAKUDD-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|