C14H16N2O9S2 — CID 3404832
[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 3404832) has the molecular formula C14H16N2O9S2 and a molecular weight of 420.42 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 3404832 |
| Molecular Formula | C14H16N2O9S2 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl] 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | CS(=O)(=O)c1ccc(C(=O)OCC(=O)NC2CCS(=O)(=O)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16N2O9S2/c1-26(21,22)12-3-2-9(6-11(12)16(19)20)14(18)25-7-13(17)15-10-4-5-27(23,24)8-10/h2-3,6,10H,4-5,7-8H2,1H3,(H,15,17) |
| InChIKey | ZSRPHRYCGKWIST-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 166.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|