C19H17N9O2 — CID 4023772
5-[[2-[5-(2-methylphenyl)tetrazol-2-yl]acetyl]amino]-2-phenyltriazole-4-carboxamide (PubChem CID 4023772) has the molecular formula C19H17N9O2 and a molecular weight of 403.41 g/mol. Its IUPAC name is 5-[[2-[5-(2-methylphenyl)tetrazol-2-yl]acetyl]amino]-2-phenyltriazole-4-carboxamide.
| Compound Name | 5-[[2-[5-(2-methylphenyl)tetrazol-2-yl]acetyl]amino]-2-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 4023772 |
| Molecular Formula | C19H17N9O2 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 5-[[2-[5-(2-methylphenyl)tetrazol-2-yl]acetyl]amino]-2-phenyltriazole-4-carboxamide |
| SMILES | Cc1ccccc1-c1nnn(CC(=O)Nc2nn(-c3ccccc3)nc2C(N)=O)n1 |
| InChI | InChI=1S/C19H17N9O2/c1-12-7-5-6-10-14(12)18-22-26-27(24-18)11-15(29)21-19-16(17(20)30)23-28(25-19)13-8-3-2-4-9-13/h2-10H,11H2,1H3,(H2,20,30)(H,21,25,29) |
| InChIKey | HMNAASWQGJTNHF-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 146.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |