C29H38N2O7 — CID 4028659
2-methyl-N-[[3,5,14-trihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methylideneamino]furan-3-carboxamide (PubChem CID 4028659) has the molecular formula C29H38N2O7 and a molecular weight of 526.63 g/mol. Its IUPAC name is 2-methyl-N-[[3,5,14-trihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methylideneamino]furan-3-carboxamide.
| Compound Name | 2-methyl-N-[[3,5,14-trihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methylideneamino]furan-3-carboxamide |
|---|---|
| PubChem CID | 4028659 |
| Molecular Formula | C29H38N2O7 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | 2-methyl-N-[[3,5,14-trihydroxy-13-methyl-17-(5-oxo-2H-furan-3-yl)-2,3,4,6,7,8,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-10-yl]methylideneamino]furan-3-carboxamide |
| SMILES | Cc1occc1C(=O)NN=CC12CCC(O)CC1(O)CCC1C2CCC2(C)C(C3=CC(=O)OC3)CCC12O |
| InChI | InChI=1S/C29H38N2O7/c1-17-20(7-12-37-17)25(34)31-30-16-27-9-3-19(32)14-28(27,35)10-5-23-22(27)4-8-26(2)21(6-11-29(23,26)36)18-13-24(33)38-15-18/h7,12-13,16,19,21-23,32,35-36H,3-6,8-11,14-15H2,1-2H3,(H,31,34) |
| InChIKey | RTMPFFLJATUAAV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 141.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|