C23H18ClN3O2 — CID 4035879
2-[(2-chlorophenyl)methoxy]-N-[1-(4-cyanophenyl)ethylideneamino]benzamide (PubChem CID 4035879) has the molecular formula C23H18ClN3O2 and a molecular weight of 403.87 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methoxy]-N-[1-(4-cyanophenyl)ethylideneamino]benzamide.
| Compound Name | 2-[(2-chlorophenyl)methoxy]-N-[1-(4-cyanophenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 4035879 |
| Molecular Formula | C23H18ClN3O2 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 2-[(2-chlorophenyl)methoxy]-N-[1-(4-cyanophenyl)ethylideneamino]benzamide |
| SMILES | CC(=NNC(=O)c1ccccc1OCc1ccccc1Cl)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C23H18ClN3O2/c1-16(18-12-10-17(14-25)11-13-18)26-27-23(28)20-7-3-5-9-22(20)29-15-19-6-2-4-8-21(19)24/h2-13H,15H2,1H3,(H,27,28) |
| InChIKey | FUZMJAVXBDDTQT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|