C40H37N3O8 — CID 4036476
2-methoxyethyl 6-(4-hydroxyphenyl)-1,2'-dioxo-3,4-diphenyl-8-(prop-2-enylcarbamoyl)spiro[4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,3'-indole]-1'-carboxylate (PubChem CID 4036476) has the molecular formula C40H37N3O8 and a molecular weight of 687.75 g/mol. Its IUPAC name is 2-methoxyethyl 6-(4-hydroxyphenyl)-1,2'-dioxo-3,4-diphenyl-8-(prop-2-enylcarbamoyl)spiro[4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,3'-indole]-1'-carboxylate.
| Compound Name | 2-methoxyethyl 6-(4-hydroxyphenyl)-1,2'-dioxo-3,4-diphenyl-8-(prop-2-enylcarbamoyl)spiro[4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,3'-indole]-1'-carboxylate |
|---|---|
| PubChem CID | 4036476 |
| Molecular Formula | C40H37N3O8 |
| Molecular Weight | 687.75 g/mol |
| Exact Mass | 687.26 |
| IUPAC Name | 2-methoxyethyl 6-(4-hydroxyphenyl)-1,2'-dioxo-3,4-diphenyl-8-(prop-2-enylcarbamoyl)spiro[4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,3'-indole]-1'-carboxylate |
| SMILES | C=CCNC(=O)C1C2C(=O)OC(c3ccccc3)C(c3ccccc3)N2C(c2ccc(O)cc2)C12C(=O)N(C(=O)OCCOC)c1ccccc12 |
| InChI | InChI=1S/C40H37N3O8/c1-3-22-41-36(45)31-33-37(46)51-34(26-14-8-5-9-15-26)32(25-12-6-4-7-13-25)43(33)35(27-18-20-28(44)21-19-27)40(31)29-16-10-11-17-30(29)42(38(40)47)39(48)50-24-23-49-2/h3-21,31-35,44H,1,22-24H2,2H3,(H,41,45) |
| InChIKey | XTTVXLNWTPNODX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 134.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.75 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|