C42H40N2O10 — CID 4029549
1-O'-(2-methoxyethyl) 8-O-prop-2-enyl 6-[3-(2-hydroxyethoxy)phenyl]-1,2'-dioxo-3,4-diphenylspiro[4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,3'-indole]-1',8-dicarboxylate (PubChem CID 4029549) has the molecular formula C42H40N2O10 and a molecular weight of 732.79 g/mol. Its IUPAC name is 1-O'-(2-methoxyethyl) 8-O-prop-2-enyl 6-[3-(2-hydroxyethoxy)phenyl]-1,2'-dioxo-3,4-diphenylspiro[4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,3'-indole]-1',8-dicarboxylate.
| Compound Name | 1-O'-(2-methoxyethyl) 8-O-prop-2-enyl 6-[3-(2-hydroxyethoxy)phenyl]-1,2'-dioxo-3,4-diphenylspiro[4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,3'-indole]-1',8-dicarboxylate |
|---|---|
| PubChem CID | 4029549 |
| Molecular Formula | C42H40N2O10 |
| Molecular Weight | 732.79 g/mol |
| Exact Mass | 732.27 |
| IUPAC Name | 1-O'-(2-methoxyethyl) 8-O-prop-2-enyl 6-[3-(2-hydroxyethoxy)phenyl]-1,2'-dioxo-3,4-diphenylspiro[4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine-7,3'-indole]-1',8-dicarboxylate |
| SMILES | C=CCOC(=O)C1C2C(=O)OC(c3ccccc3)C(c3ccccc3)N2C(c2cccc(OCCO)c2)C12C(=O)N(C(=O)OCCOC)c1ccccc12 |
| InChI | InChI=1S/C42H40N2O10/c1-3-22-52-38(46)33-35-39(47)54-36(28-15-8-5-9-16-28)34(27-13-6-4-7-14-27)44(35)37(29-17-12-18-30(26-29)51-23-21-45)42(33)31-19-10-11-20-32(31)43(40(42)48)41(49)53-25-24-50-2/h3-20,26,33-37,45H,1,21-25H2,2H3 |
| InChIKey | AEMSNBACZRXOIE-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 141.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.79 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|