C38H34N2O7 — CID 6728962
prop-2-enyl (3R,3'R,4'S,6'R,8'S,8'aS)-6'-[4-(2-hydroxyethoxy)phenyl]-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxylate (PubChem CID 6728962) has the molecular formula C38H34N2O7 and a molecular weight of 630.70 g/mol. Its IUPAC name is prop-2-enyl (3R,3'R,4'S,6'R,8'S,8'aS)-6'-[4-(2-hydroxyethoxy)phenyl]-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxylate.
| Compound Name | prop-2-enyl (3R,3'R,4'S,6'R,8'S,8'aS)-6'-[4-(2-hydroxyethoxy)phenyl]-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxylate |
|---|---|
| PubChem CID | 6728962 |
| Molecular Formula | C38H34N2O7 |
| Molecular Weight | 630.70 g/mol |
| Exact Mass | 630.24 |
| IUPAC Name | prop-2-enyl (3R,3'R,4'S,6'R,8'S,8'aS)-6'-[4-(2-hydroxyethoxy)phenyl]-1',2-dioxo-3',4'-diphenylspiro[1H-indole-3,7'-4,6,8,8a-tetrahydro-3H-pyrrolo[2,1-c][1,4]oxazine]-8'-carboxylate |
| SMILES | C=CCOC(=O)[C@@H]1[C@H]2C(=O)O[C@H](c3ccccc3)[C@H](c3ccccc3)N2[C@H](c2ccc(OCCO)cc2)[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C38H34N2O7/c1-2-22-46-35(42)30-32-36(43)47-33(25-13-7-4-8-14-25)31(24-11-5-3-6-12-24)40(32)34(26-17-19-27(20-18-26)45-23-21-41)38(30)28-15-9-10-16-29(28)39-37(38)44/h2-20,30-34,41H,1,21-23H2,(H,39,44)/t30-,31-,32-,33+,34+,38-/m0/s1 |
| InChIKey | NIBNKLLTAVVXLC-NVQZCDRISA-N |
| XLogP | 5.06 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.70 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|