C20H12BrClN2O3 — CID 4036984
5-(5-bromo-2-hydroxybenzoyl)-1-[(4-chlorophenyl)methyl]-2-oxopyridine-3-carbonitrile (PubChem CID 4036984) has the molecular formula C20H12BrClN2O3 and a molecular weight of 443.68 g/mol. Its IUPAC name is 5-(5-bromo-2-hydroxybenzoyl)-1-[(4-chlorophenyl)methyl]-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-(5-bromo-2-hydroxybenzoyl)-1-[(4-chlorophenyl)methyl]-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 4036984 |
| Molecular Formula | C20H12BrClN2O3 |
| Molecular Weight | 443.68 g/mol |
| Exact Mass | 441.97 |
| IUPAC Name | 5-(5-bromo-2-hydroxybenzoyl)-1-[(4-chlorophenyl)methyl]-2-oxopyridine-3-carbonitrile |
| SMILES | N#Cc1cc(C(=O)c2cc(Br)ccc2O)cn(Cc2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C20H12BrClN2O3/c21-15-3-6-18(25)17(8-15)19(26)14-7-13(9-23)20(27)24(11-14)10-12-1-4-16(22)5-2-12/h1-8,11,25H,10H2 |
| InChIKey | KLYIEMPHAWPYRP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.68 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |