C9H8N2O2 — CID 4039462
3-(2-hydroxyphenyl)-1,4-dihydropyrazol-5-one (PubChem CID 4039462) has the molecular formula C9H8N2O2 and a molecular weight of 176.18 g/mol. Its IUPAC name is 3-(2-hydroxyphenyl)-1,4-dihydropyrazol-5-one.
| Compound Name | 3-(2-hydroxyphenyl)-1,4-dihydropyrazol-5-one |
|---|---|
| PubChem CID | 4039462 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 3-(2-hydroxyphenyl)-1,4-dihydropyrazol-5-one |
| SMILES | O=C1CC(c2ccccc2O)=NN1 |
| InChI | InChI=1S/C9H8N2O2/c12-8-4-2-1-3-6(8)7-5-9(13)11-10-7/h1-4,12H,5H2,(H,11,13) |
| InChIKey | PKRMXFQTESAARM-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|