C18H26N2O3 — CID 4044083
2-nitro-6-[(4-pentylcyclohexyl)iminomethyl]phenol (PubChem CID 4044083) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-nitro-6-[(4-pentylcyclohexyl)iminomethyl]phenol.
| Compound Name | 2-nitro-6-[(4-pentylcyclohexyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 4044083 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 2-nitro-6-[(4-pentylcyclohexyl)iminomethyl]phenol |
| SMILES | CCCCCC1CCC(/N=C/c2cccc([N+](=O)[O-])c2O)CC1 |
| InChI | InChI=1S/C18H26N2O3/c1-2-3-4-6-14-9-11-16(12-10-14)19-13-15-7-5-8-17(18(15)21)20(22)23/h5,7-8,13-14,16,21H,2-4,6,9-12H2,1H3/b19-13+ |
| InChIKey | WOQLUMOZHNWQPK-CPNJWEJPSA-N |
| XLogP | 4.86 |
| TPSA | 75.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|