C23H22N4O6S3 — CID 4047592
methyl 2-[[2-[2-[(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl]sulfanylacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 4047592) has the molecular formula C23H22N4O6S3 and a molecular weight of 546.65 g/mol. Its IUPAC name is methyl 2-[[2-[2-[(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl]sulfanylacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[2-[(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl]sulfanylacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4047592 |
| Molecular Formula | C23H22N4O6S3 |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.07 |
| IUPAC Name | methyl 2-[[2-[2-[(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl]sulfanylacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | C=CCn1/c(=N/C(=O)CSCC(=O)Nc2sc3c(c2C(=O)OC)CCC3)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C23H22N4O6S3/c1-3-9-26-15-8-7-13(27(31)32)10-17(15)36-23(26)25-19(29)12-34-11-18(28)24-21-20(22(30)33-2)14-5-4-6-16(14)35-21/h3,7-8,10H,1,4-6,9,11-12H2,2H3,(H,24,28)/b25-23- |
| InChIKey | CJWZSDGYNMGYCO-BZZOAKBMSA-N |
| XLogP | 3.93 |
| TPSA | 132.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|