C24H24N4O6S3 — CID 3250187
ethyl 2-[[2-[2-[(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl]sulfanylacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 3250187) has the molecular formula C24H24N4O6S3 and a molecular weight of 560.68 g/mol. Its IUPAC name is ethyl 2-[[2-[2-[(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl]sulfanylacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[2-[(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl]sulfanylacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3250187 |
| Molecular Formula | C24H24N4O6S3 |
| Molecular Weight | 560.68 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | ethyl 2-[[2-[2-[(6-nitro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)amino]-2-oxoethyl]sulfanylacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | C=CCn1/c(=N/C(=O)CSCC(=O)Nc2sc3c(c2C(=O)OCC)CCC3)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C24H24N4O6S3/c1-3-10-27-16-9-8-14(28(32)33)11-18(16)37-24(27)26-20(30)13-35-12-19(29)25-22-21(23(31)34-4-2)15-6-5-7-17(15)36-22/h3,8-9,11H,1,4-7,10,12-13H2,2H3,(H,25,29)/b26-24- |
| InChIKey | JRRPCYBIUIHFIT-LCUIJRPUSA-N |
| XLogP | 4.32 |
| TPSA | 132.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.68 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|