C27H32N4O7S3 — CID 4056814
ethyl 2-[[2-[2-[[3-(2-ethoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]amino]-2-oxoethyl]sulfanylacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4056814) has the molecular formula C27H32N4O7S3 and a molecular weight of 620.78 g/mol. Its IUPAC name is ethyl 2-[[2-[2-[[3-(2-ethoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]amino]-2-oxoethyl]sulfanylacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[2-[[3-(2-ethoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]amino]-2-oxoethyl]sulfanylacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4056814 |
| Molecular Formula | C27H32N4O7S3 |
| Molecular Weight | 620.78 g/mol |
| Exact Mass | 620.14 |
| IUPAC Name | ethyl 2-[[2-[2-[[3-(2-ethoxyethyl)-6-nitro-1,3-benzothiazol-2-ylidene]amino]-2-oxoethyl]sulfanylacetyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOCCn1/c(=N/C(=O)CSCC(=O)Nc2sc3c(c2C(=O)OCC)CCC(C)C3)sc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C27H32N4O7S3/c1-4-37-11-10-30-19-9-7-17(31(35)36)13-21(19)41-27(30)29-23(33)15-39-14-22(32)28-25-24(26(34)38-5-2)18-8-6-16(3)12-20(18)40-25/h7,9,13,16H,4-6,8,10-12,14-15H2,1-3H3,(H,28,32)/b29-27- |
| InChIKey | AJKYHLSMJHLHOW-OHYPFYFLSA-N |
| XLogP | 4.81 |
| TPSA | 142.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.78 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|