C19H27N5O2 — CID 4049253
3-(4-methylpiperazin-1-yl)propyl 3-amino-1-benzylpyrazole-4-carboxylate (PubChem CID 4049253) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)propyl 3-amino-1-benzylpyrazole-4-carboxylate.
| Compound Name | 3-(4-methylpiperazin-1-yl)propyl 3-amino-1-benzylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 4049253 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)propyl 3-amino-1-benzylpyrazole-4-carboxylate |
| SMILES | CN1CCN(CCCOC(=O)c2cn(Cc3ccccc3)nc2N)CC1 |
| InChI | InChI=1S/C19H27N5O2/c1-22-9-11-23(12-10-22)8-5-13-26-19(25)17-15-24(21-18(17)20)14-16-6-3-2-4-7-16/h2-4,6-7,15H,5,8-14H2,1H3,(H2,20,21) |
| InChIKey | OABOQKCRGVHEFI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 76.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|