C20H25N3S — CID 4049606
1-cyclopentyl-3-(2,6-dimethylphenyl)-1-(pyridin-2-ylmethyl)thiourea (PubChem CID 4049606) has the molecular formula C20H25N3S and a molecular weight of 339.51 g/mol. Its IUPAC name is 1-cyclopentyl-3-(2,6-dimethylphenyl)-1-(pyridin-2-ylmethyl)thiourea.
| Compound Name | 1-cyclopentyl-3-(2,6-dimethylphenyl)-1-(pyridin-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4049606 |
| Molecular Formula | C20H25N3S |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 1-cyclopentyl-3-(2,6-dimethylphenyl)-1-(pyridin-2-ylmethyl)thiourea |
| SMILES | Cc1cccc(C)c1NC(=S)N(Cc1ccccn1)C1CCCC1 |
| InChI | InChI=1S/C20H25N3S/c1-15-8-7-9-16(2)19(15)22-20(24)23(18-11-3-4-12-18)14-17-10-5-6-13-21-17/h5-10,13,18H,3-4,11-12,14H2,1-2H3,(H,22,24) |
| InChIKey | OUNAFWOLPRBVHN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|