C19H27N5O — CID 118782661
1-cyclohexyl-3-(1-propan-2-ylpyrazol-4-yl)-1-(pyridin-2-ylmethyl)urea (PubChem CID 118782661) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is 1-cyclohexyl-3-(1-propan-2-ylpyrazol-4-yl)-1-(pyridin-2-ylmethyl)urea.
| Compound Name | 1-cyclohexyl-3-(1-propan-2-ylpyrazol-4-yl)-1-(pyridin-2-ylmethyl)urea |
|---|---|
| PubChem CID | 118782661 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | 1-cyclohexyl-3-(1-propan-2-ylpyrazol-4-yl)-1-(pyridin-2-ylmethyl)urea |
| SMILES | CC(C)n1cc(NC(=O)N(Cc2ccccn2)C2CCCCC2)cn1 |
| InChI | InChI=1S/C19H27N5O/c1-15(2)24-14-17(12-21-24)22-19(25)23(18-9-4-3-5-10-18)13-16-8-6-7-11-20-16/h6-8,11-12,14-15,18H,3-5,9-10,13H2,1-2H3,(H,22,25) |
| InChIKey | GRDJTNWEQXAQIE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |