C15H20N4O4S2 — CID 40502137
(3R)-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-(2-methoxyethyl)piperidine-3-carboxamide (PubChem CID 40502137) has the molecular formula C15H20N4O4S2 and a molecular weight of 384.48 g/mol. Its IUPAC name is (3R)-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-(2-methoxyethyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-(2-methoxyethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 40502137 |
| Molecular Formula | C15H20N4O4S2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | (3R)-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-(2-methoxyethyl)piperidine-3-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1CCCN(S(=O)(=O)c2cccc3nsnc23)C1 |
| InChI | InChI=1S/C15H20N4O4S2/c1-23-9-7-16-15(20)11-4-3-8-19(10-11)25(21,22)13-6-2-5-12-14(13)18-24-17-12/h2,5-6,11H,3-4,7-10H2,1H3,(H,16,20)/t11-/m1/s1 |
| InChIKey | ORBAJRTZBJRABW-LLVKDONJSA-N |
| XLogP | 0.85 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|