C21H31N5O3S2 — CID 124771864
(3S)-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]piperidine-3-carboxamide (PubChem CID 124771864) has the molecular formula C21H31N5O3S2 and a molecular weight of 465.65 g/mol. Its IUPAC name is (3S)-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 124771864 |
| Molecular Formula | C21H31N5O3S2 |
| Molecular Weight | 465.65 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | (3S)-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]piperidine-3-carboxamide |
| SMILES | C[C@@H]1CCCN(CCCNC(=O)[C@H]2CCCN(S(=O)(=O)c3cccc4nsnc34)C2)C1 |
| InChI | InChI=1S/C21H31N5O3S2/c1-16-6-3-11-25(14-16)12-5-10-22-21(27)17-7-4-13-26(15-17)31(28,29)19-9-2-8-18-20(19)24-30-23-18/h2,8-9,16-17H,3-7,10-15H2,1H3,(H,22,27)/t16-,17+/m1/s1 |
| InChIKey | FDTOURZIXDDJIL-SJORKVTESA-N |
| XLogP | 2.33 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.65 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|