C21H31N5O3S2 — CID 20853494
N-[3-(azepan-1-yl)propyl]-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperidine-4-carboxamide (PubChem CID 20853494) has the molecular formula C21H31N5O3S2 and a molecular weight of 465.65 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperidine-4-carboxamide.
| Compound Name | N-[3-(azepan-1-yl)propyl]-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20853494 |
| Molecular Formula | C21H31N5O3S2 |
| Molecular Weight | 465.65 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-1-(2,1,3-benzothiadiazol-4-ylsulfonyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCCN1CCCCCC1)C1CCN(S(=O)(=O)c2cccc3nsnc23)CC1 |
| InChI | InChI=1S/C21H31N5O3S2/c27-21(22-11-6-14-25-12-3-1-2-4-13-25)17-9-15-26(16-10-17)31(28,29)19-8-5-7-18-20(19)24-30-23-18/h5,7-8,17H,1-4,6,9-16H2,(H,22,27) |
| InChIKey | OSZKSJJQNZKLMN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.65 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|