C21H20ClN3O4S — CID 4050229
N-(3-chloro-4-methoxyphenyl)-4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1H-quinazoline-7-carboxamide (PubChem CID 4050229) has the molecular formula C21H20ClN3O4S and a molecular weight of 445.93 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1H-quinazoline-7-carboxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1H-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 4050229 |
| Molecular Formula | C21H20ClN3O4S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-4-oxo-3-(oxolan-2-ylmethyl)-2-sulfanylidene-1H-quinazoline-7-carboxamide |
| SMILES | COc1ccc(NC(=O)c2ccc3c(=O)n(CC4CCCO4)c(=S)[nH]c3c2)cc1Cl |
| InChI | InChI=1S/C21H20ClN3O4S/c1-28-18-7-5-13(10-16(18)22)23-19(26)12-4-6-15-17(9-12)24-21(30)25(20(15)27)11-14-3-2-8-29-14/h4-7,9-10,14H,2-3,8,11H2,1H3,(H,23,26)(H,24,30) |
| InChIKey | ATEWMRCMWKQFKU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|