C14H13N2O4S- — CID 6937768
4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1H-quinazoline-7-carboxylate (PubChem CID 6937768) has the molecular formula C14H13N2O4S- and a molecular weight of 305.33 g/mol. Its IUPAC name is 4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1H-quinazoline-7-carboxylate.
| Compound Name | 4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 6937768 |
| Molecular Formula | C14H13N2O4S- |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-2-sulfanylidene-1H-quinazoline-7-carboxylate |
| SMILES | O=C([O-])c1ccc2c(=O)n(C[C@H]3CCCO3)c(=S)[nH]c2c1 |
| InChI | InChI=1S/C14H14N2O4S/c17-12-10-4-3-8(13(18)19)6-11(10)15-14(21)16(12)7-9-2-1-5-20-9/h3-4,6,9H,1-2,5,7H2,(H,15,21)(H,18,19)/p-1/t9-/m1/s1 |
| InChIKey | YDMDOYQKAGFQND-SECBINFHSA-M |
| XLogP | 0.60 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|