C25H25N3O3S — CID 3502182
3-(oxolan-2-ylmethyl)-7-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 3502182) has the molecular formula C25H25N3O3S and a molecular weight of 447.56 g/mol. Its IUPAC name is 3-(oxolan-2-ylmethyl)-7-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-(oxolan-2-ylmethyl)-7-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 3502182 |
| Molecular Formula | C25H25N3O3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 3-(oxolan-2-ylmethyl)-7-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | O=C(c1ccc2c(=O)n(CC3CCCO3)c(=S)[nH]c2c1)N1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H25N3O3S/c29-23(27-12-10-18(11-13-27)17-5-2-1-3-6-17)19-8-9-21-22(15-19)26-25(32)28(24(21)30)16-20-7-4-14-31-20/h1-3,5-6,8-10,15,20H,4,7,11-14,16H2,(H,26,32) |
| InChIKey | HFDVZIDWEQEKNM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|