C18H13ClN4O3S — CID 40506251
4-chloro-N-[3-(2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]-3-nitrobenzamide (PubChem CID 40506251) has the molecular formula C18H13ClN4O3S and a molecular weight of 400.85 g/mol. Its IUPAC name is 4-chloro-N-[3-(2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[3-(2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 40506251 |
| Molecular Formula | C18H13ClN4O3S |
| Molecular Weight | 400.85 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 4-chloro-N-[3-(2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]-3-nitrobenzamide |
| SMILES | O=C(Nc1cccc(-c2cn3c(n2)SCC3)c1)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H13ClN4O3S/c19-14-5-4-12(9-16(14)23(25)26)17(24)20-13-3-1-2-11(8-13)15-10-22-6-7-27-18(22)21-15/h1-5,8-10H,6-7H2,(H,20,24) |
| InChIKey | FYBFXSDUFSBUEW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.85 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|