C18H13N5O5S — CID 41427391
N-[4-(2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]-3,5-dinitrobenzamide (PubChem CID 41427391) has the molecular formula C18H13N5O5S and a molecular weight of 411.40 g/mol. Its IUPAC name is N-[4-(2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]-3,5-dinitrobenzamide.
| Compound Name | N-[4-(2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 41427391 |
| Molecular Formula | C18H13N5O5S |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | N-[4-(2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]-3,5-dinitrobenzamide |
| SMILES | O=C(Nc1ccc(-c2cn3c(n2)SCC3)cc1)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H13N5O5S/c24-17(12-7-14(22(25)26)9-15(8-12)23(27)28)19-13-3-1-11(2-4-13)16-10-21-5-6-29-18(21)20-16/h1-4,7-10H,5-6H2,(H,19,24) |
| InChIKey | GIJICLGQXUUPJL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|