C12H12ClF2NO4 — CID 4050631
methyl 4-chloro-4,4-difluoro-2-formamido-3-hydroxy-3-phenylbutanoate (PubChem CID 4050631) has the molecular formula C12H12ClF2NO4 and a molecular weight of 307.68 g/mol. Its IUPAC name is methyl 4-chloro-4,4-difluoro-2-formamido-3-hydroxy-3-phenylbutanoate.
| Compound Name | methyl 4-chloro-4,4-difluoro-2-formamido-3-hydroxy-3-phenylbutanoate |
|---|---|
| PubChem CID | 4050631 |
| Molecular Formula | C12H12ClF2NO4 |
| Molecular Weight | 307.68 g/mol |
| Exact Mass | 307.04 |
| IUPAC Name | methyl 4-chloro-4,4-difluoro-2-formamido-3-hydroxy-3-phenylbutanoate |
| SMILES | COC(=O)C(NC=O)C(O)(c1ccccc1)C(F)(F)Cl |
| InChI | InChI=1S/C12H12ClF2NO4/c1-20-10(18)9(16-7-17)11(19,12(13,14)15)8-5-3-2-4-6-8/h2-7,9,19H,1H3,(H,16,17) |
| InChIKey | CPLBMUNMLZPEHN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.68 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|