C19H22N6O2 — CID 40509708
(4S)-3,4,7,9-tetramethyl-1-(2-phenylethyl)-4H-purino[8,7-c][1,2,4]triazine-6,8-dione (PubChem CID 40509708) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is (4S)-3,4,7,9-tetramethyl-1-(2-phenylethyl)-4H-purino[8,7-c][1,2,4]triazine-6,8-dione.
| Compound Name | (4S)-3,4,7,9-tetramethyl-1-(2-phenylethyl)-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 40509708 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (4S)-3,4,7,9-tetramethyl-1-(2-phenylethyl)-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
| SMILES | CC1=NN(CCc2ccccc2)c2nc3c(c(=O)n(C)c(=O)n3C)n2[C@H]1C |
| InChI | InChI=1S/C19H22N6O2/c1-12-13(2)25-15-16(22(3)19(27)23(4)17(15)26)20-18(25)24(21-12)11-10-14-8-6-5-7-9-14/h5-9,13H,10-11H2,1-4H3/t13-/m0/s1 |
| InChIKey | OSOGPSJOOWPRIL-ZDUSSCGKSA-N |
| XLogP | 1.43 |
| TPSA | 77.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |