C23H31N7O2 — CID 43988646
1-[2-(4-butylanilino)ethyl]-3,4,7,9-tetramethyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione (PubChem CID 43988646) has the molecular formula C23H31N7O2 and a molecular weight of 437.55 g/mol. Its IUPAC name is 1-[2-(4-butylanilino)ethyl]-3,4,7,9-tetramethyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione.
| Compound Name | 1-[2-(4-butylanilino)ethyl]-3,4,7,9-tetramethyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 43988646 |
| Molecular Formula | C23H31N7O2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 1-[2-(4-butylanilino)ethyl]-3,4,7,9-tetramethyl-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
| SMILES | CCCCc1ccc(NCCN2N=C(C)C(C)n3c2nc2c3c(=O)n(C)c(=O)n2C)cc1 |
| InChI | InChI=1S/C23H31N7O2/c1-6-7-8-17-9-11-18(12-10-17)24-13-14-29-22-25-20-19(30(22)16(3)15(2)26-29)21(31)28(5)23(32)27(20)4/h9-12,16,24H,6-8,13-14H2,1-5H3 |
| InChIKey | YXJLGJXOXSPMMC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 89.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |