C21H23N3O4 — CID 40519874
ethyl 4-[[1-(2-methoxyethyl)indol-3-yl]carbamoylamino]benzoate (PubChem CID 40519874) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is ethyl 4-[[1-(2-methoxyethyl)indol-3-yl]carbamoylamino]benzoate.
| Compound Name | ethyl 4-[[1-(2-methoxyethyl)indol-3-yl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 40519874 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | ethyl 4-[[1-(2-methoxyethyl)indol-3-yl]carbamoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)Nc2cn(CCOC)c3ccccc23)cc1 |
| InChI | InChI=1S/C21H23N3O4/c1-3-28-20(25)15-8-10-16(11-9-15)22-21(26)23-18-14-24(12-13-27-2)19-7-5-4-6-17(18)19/h4-11,14H,3,12-13H2,1-2H3,(H2,22,23,26) |
| InChIKey | WVKLNSFNJFIEBH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |